C7H7F4N3 — CID 11615416
N'-(2,3,5,6-tetrafluoro-4-pyridinyl)ethane-1,2-diamine (PubChem CID 11615416) has the molecular formula C7H7F4N3 and a molecular weight of 209.15 g/mol. Its IUPAC name is N'-(2,3,5,6-tetrafluoro-4-pyridinyl)ethane-1,2-diamine.
| Compound Name | N'-(2,3,5,6-tetrafluoro-4-pyridinyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 11615416 |
| Molecular Formula | C7H7F4N3 |
| Molecular Weight | 209.15 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | N'-(2,3,5,6-tetrafluoro-4-pyridinyl)ethane-1,2-diamine |
| SMILES | NCCNc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C7H7F4N3/c8-3-5(13-2-1-12)4(9)7(11)14-6(3)10/h1-2,12H2,(H,13,14) |
| InChIKey | DGPLHBDJAGYXTG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.15 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|