C16H14F8N4 — CID 132602371
2-methyl-N,N'-bis(2,3,5,6-tetrafluoro-4-pyridinyl)pentane-1,5-diamine (PubChem CID 132602371) has the molecular formula C16H14F8N4 and a molecular weight of 414.30 g/mol. Its IUPAC name is 2-methyl-N,N'-bis(2,3,5,6-tetrafluoro-4-pyridinyl)pentane-1,5-diamine.
| Compound Name | 2-methyl-N,N'-bis(2,3,5,6-tetrafluoro-4-pyridinyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 132602371 |
| Molecular Formula | C16H14F8N4 |
| Molecular Weight | 414.30 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | 2-methyl-N,N'-bis(2,3,5,6-tetrafluoro-4-pyridinyl)pentane-1,5-diamine |
| SMILES | CC(CCCNc1c(F)c(F)nc(F)c1F)CNc1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C16H14F8N4/c1-6(5-26-12-9(19)15(23)28-16(24)10(12)20)3-2-4-25-11-7(17)13(21)27-14(22)8(11)18/h6H,2-5H2,1H3,(H,25,27)(H,26,28) |
| InChIKey | UNIKADKGXDNQRF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.30 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|