C10H13F4N2+ — CID 58320110
N-tert-butyl-2,3,5,6-tetrafluoro-1-methylpyridin-1-ium-4-amine (PubChem CID 58320110) has the molecular formula C10H13F4N2+ and a molecular weight of 237.22 g/mol. Its IUPAC name is N-tert-butyl-2,3,5,6-tetrafluoro-1-methylpyridin-1-ium-4-amine.
| Compound Name | N-tert-butyl-2,3,5,6-tetrafluoro-1-methylpyridin-1-ium-4-amine |
|---|---|
| PubChem CID | 58320110 |
| Molecular Formula | C10H13F4N2+ |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-tert-butyl-2,3,5,6-tetrafluoro-1-methylpyridin-1-ium-4-amine |
| SMILES | C[n+]1c(F)c(F)c(NC(C)(C)C)c(F)c1F |
| InChI | InChI=1S/C10H12F4N2/c1-10(2,3)15-7-5(11)8(13)16(4)9(14)6(7)12/h1-4H3/p+1 |
| InChIKey | IGLJTBNFJQOUIH-UHFFFAOYSA-O |
| XLogP | 2.28 |
| TPSA | 15.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|