C9H9F4N3O — CID 139248728
N-tert-butyl-N-(2,3,5,6-tetrafluoro-4-pyridinyl)nitrous amide (PubChem CID 139248728) has the molecular formula C9H9F4N3O and a molecular weight of 251.18 g/mol. Its IUPAC name is N-tert-butyl-N-(2,3,5,6-tetrafluoro-4-pyridinyl)nitrous amide.
| Compound Name | N-tert-butyl-N-(2,3,5,6-tetrafluoro-4-pyridinyl)nitrous amide |
|---|---|
| PubChem CID | 139248728 |
| Molecular Formula | C9H9F4N3O |
| Molecular Weight | 251.18 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | N-tert-butyl-N-(2,3,5,6-tetrafluoro-4-pyridinyl)nitrous amide |
| SMILES | CC(C)(C)N(N=O)c1c(F)c(F)nc(F)c1F |
| InChI | InChI=1S/C9H9F4N3O/c1-9(2,3)16(15-17)6-4(10)7(12)14-8(13)5(6)11/h1-3H3 |
| InChIKey | ABJPWJVCVBTTIO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.18 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|