C11H14F4N2 — CID 14322657
2,3,5,6-tetrafluoro-N,N-di(propan-2-yl)pyridin-4-amine (PubChem CID 14322657) has the molecular formula C11H14F4N2 and a molecular weight of 250.24 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-N,N-di(propan-2-yl)pyridin-4-amine.
| Compound Name | 2,3,5,6-tetrafluoro-N,N-di(propan-2-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 14322657 |
| Molecular Formula | C11H14F4N2 |
| Molecular Weight | 250.24 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 2,3,5,6-tetrafluoro-N,N-di(propan-2-yl)pyridin-4-amine |
| SMILES | CC(C)N(c1c(F)c(F)nc(F)c1F)C(C)C |
| InChI | InChI=1S/C11H14F4N2/c1-5(2)17(6(3)4)9-7(12)10(14)16-11(15)8(9)13/h5-6H,1-4H3 |
| InChIKey | STHNWYOHPWOKDZ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|