C5Cl2F4N2 — CID 12568725
N,N-dichloro-2,3,5,6-tetrafluoropyridin-4-amine (PubChem CID 12568725) has the molecular formula C5Cl2F4N2 and a molecular weight of 234.97 g/mol. Its IUPAC name is N,N-dichloro-2,3,5,6-tetrafluoropyridin-4-amine.
| Compound Name | N,N-dichloro-2,3,5,6-tetrafluoropyridin-4-amine |
|---|---|
| PubChem CID | 12568725 |
| Molecular Formula | C5Cl2F4N2 |
| Molecular Weight | 234.97 g/mol |
| Exact Mass | 233.94 |
| IUPAC Name | N,N-dichloro-2,3,5,6-tetrafluoropyridin-4-amine |
| SMILES | Fc1nc(F)c(F)c(N(Cl)Cl)c1F |
| InChI | InChI=1S/C5Cl2F4N2/c6-13(7)3-1(8)4(10)12-5(11)2(3)9 |
| InChIKey | BGEMQKIVFFRUJU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.97 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|