C11H2F8N2O2 — CID 135291032
2,3,5,6-tetrafluoro-4-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxymethoxy]pyridine (PubChem CID 135291032) has the molecular formula C11H2F8N2O2 and a molecular weight of 346.13 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxymethoxy]pyridine.
| Compound Name | 2,3,5,6-tetrafluoro-4-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxymethoxy]pyridine |
|---|---|
| PubChem CID | 135291032 |
| Molecular Formula | C11H2F8N2O2 |
| Molecular Weight | 346.13 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[(2,3,5,6-tetrafluoro-4-pyridinyl)oxymethoxy]pyridine |
| SMILES | Fc1nc(F)c(F)c(OCOc2c(F)c(F)nc(F)c2F)c1F |
| InChI | InChI=1S/C11H2F8N2O2/c12-2-6(3(13)9(17)20-8(2)16)22-1-23-7-4(14)10(18)21-11(19)5(7)15/h1H2 |
| InChIKey | FRPCMNSBOCIQEZ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.13 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|