C5H2F4N2 — CID 70491067
4,5,6-trifluoro-2-(fluoromethyl)pyrimidine (PubChem CID 70491067) has the molecular formula C5H2F4N2 and a molecular weight of 166.08 g/mol. Its IUPAC name is 4,5,6-trifluoro-2-(fluoromethyl)pyrimidine.
| Compound Name | 4,5,6-trifluoro-2-(fluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 70491067 |
| Molecular Formula | C5H2F4N2 |
| Molecular Weight | 166.08 g/mol |
| Exact Mass | 166.02 |
| IUPAC Name | 4,5,6-trifluoro-2-(fluoromethyl)pyrimidine |
| SMILES | FCc1nc(F)c(F)c(F)n1 |
| InChI | InChI=1S/C5H2F4N2/c6-1-2-10-4(8)3(7)5(9)11-2/h1H2 |
| InChIKey | RYBRKQWIGGGISM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.08 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |