C7H6F3N — CID 20792086
2,3,6-trifluoro-4,5-dimethylpyridine (PubChem CID 20792086) has the molecular formula C7H6F3N and a molecular weight of 161.13 g/mol. Its IUPAC name is 2,3,6-trifluoro-4,5-dimethylpyridine.
| Compound Name | 2,3,6-trifluoro-4,5-dimethylpyridine |
|---|---|
| PubChem CID | 20792086 |
| Molecular Formula | C7H6F3N |
| Molecular Weight | 161.13 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 2,3,6-trifluoro-4,5-dimethylpyridine |
| SMILES | Cc1c(F)nc(F)c(F)c1C |
| InChI | InChI=1S/C7H6F3N/c1-3-4(2)6(9)11-7(10)5(3)8/h1-2H3 |
| InChIKey | CBKKFRSZGFGLTJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.13 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|