About 3,5-dichloro-2,6-difluoro-4-methylpyridine
3,5-dichloro-2,6-difluoro-4-methylpyridine (PubChem CID 54345490) has the molecular formula C6H3Cl2F2N
and a molecular weight of 198.00 g/mol. Its IUPAC name is 3,5-dichloro-2,6-difluoro-4-methylpyridine.
Molecular Properties
| Compound Name | 3,5-dichloro-2,6-difluoro-4-methylpyridine |
| PubChem CID | 54345490 |
| Molecular Formula | C6H3Cl2F2N |
| Molecular Weight | 198.00 g/mol |
| Exact Mass | 196.96 |
| IUPAC Name | 3,5-dichloro-2,6-difluoro-4-methylpyridine |
| SMILES | Cc1c(Cl)c(F)nc(F)c1Cl |
| InChI | InChI=1S/C6H3Cl2F2N/c1-2-3(7)5(9)11-6(10)4(2)8/h1H3 |
| InChIKey | AEQZLGOQOKWZJK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.00 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-2,6-difluoro-4-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-2,6-difluoro-4-methylpyridine?
The IUPAC name of 3,5-dichloro-2,6-difluoro-4-methylpyridine (CID 54345490) is 3,5-dichloro-2,6-difluoro-4-methylpyridine.
What is the SMILES notation for 3,5-dichloro-2,6-difluoro-4-methylpyridine?
The canonical SMILES for 3,5-dichloro-2,6-difluoro-4-methylpyridine is Cc1c(Cl)c(F)nc(F)c1Cl.
What is the InChIKey of 3,5-dichloro-2,6-difluoro-4-methylpyridine?
The InChIKey is AEQZLGOQOKWZJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2F2N/c1-2-3(7)5(9)11-6(10)4(2)8/h1H3.
What are the key properties of 3,5-dichloro-2,6-difluoro-4-methylpyridine?
3,5-dichloro-2,6-difluoro-4-methylpyridine has a molecular weight of 198.00 g/mol, XLogP of 2.98, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-2,6-difluoro-4-methylpyridine is sourced from PubChem (CID 54345490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).