C6H3Cl2F2N — CID 54345490
3,5-dichloro-2,6-difluoro-4-methylpyridine (PubChem CID 54345490) has the molecular formula C6H3Cl2F2N and a molecular weight of 198.00 g/mol. Its IUPAC name is 3,5-dichloro-2,6-difluoro-4-methylpyridine.
| Compound Name | 3,5-dichloro-2,6-difluoro-4-methylpyridine |
|---|---|
| PubChem CID | 54345490 |
| Molecular Formula | C6H3Cl2F2N |
| Molecular Weight | 198.00 g/mol |
| Exact Mass | 196.96 |
| IUPAC Name | 3,5-dichloro-2,6-difluoro-4-methylpyridine |
| SMILES | Cc1c(Cl)c(F)nc(F)c1Cl |
| InChI | InChI=1S/C6H3Cl2F2N/c1-2-3(7)5(9)11-6(10)4(2)8/h1H3 |
| InChIKey | AEQZLGOQOKWZJK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.00 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|