C7H6ClF3N2 — CID 23234820
5-chloro-3,4,6-trifluoro-N,N-dimethylpyridin-2-amine (PubChem CID 23234820) has the molecular formula C7H6ClF3N2 and a molecular weight of 210.59 g/mol. Its IUPAC name is 5-chloro-3,4,6-trifluoro-N,N-dimethylpyridin-2-amine.
| Compound Name | 5-chloro-3,4,6-trifluoro-N,N-dimethylpyridin-2-amine |
|---|---|
| PubChem CID | 23234820 |
| Molecular Formula | C7H6ClF3N2 |
| Molecular Weight | 210.59 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | 5-chloro-3,4,6-trifluoro-N,N-dimethylpyridin-2-amine |
| SMILES | CN(C)c1nc(F)c(Cl)c(F)c1F |
| InChI | InChI=1S/C7H6ClF3N2/c1-13(2)7-5(10)4(9)3(8)6(11)12-7/h1-2H3 |
| InChIKey | RIASXGHAGGHENJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.59 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|