C5H4ClF3N2 — CID 162065377
5-chloro-2,4,6-trifluoropyrimidine;methane (PubChem CID 162065377) has the molecular formula C5H4ClF3N2 and a molecular weight of 184.55 g/mol. Its IUPAC name is 5-chloro-2,4,6-trifluoropyrimidine;methane.
| Compound Name | 5-chloro-2,4,6-trifluoropyrimidine;methane |
|---|---|
| PubChem CID | 162065377 |
| Molecular Formula | C5H4ClF3N2 |
| Molecular Weight | 184.55 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | 5-chloro-2,4,6-trifluoropyrimidine;methane |
| SMILES | C.Fc1nc(F)c(Cl)c(F)n1 |
| InChI | InChI=1S/C4ClF3N2.CH4/c5-1-2(6)9-4(8)10-3(1)7;/h;1H4 |
| InChIKey | ZAJSQDNGWJWNEM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.55 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |