C4F3IN2 — CID 143789968
2,4,6-trifluoro-5-iodopyrimidine (PubChem CID 143789968) has the molecular formula C4F3IN2 and a molecular weight of 259.96 g/mol. Its IUPAC name is 2,4,6-trifluoro-5-iodopyrimidine.
| Compound Name | 2,4,6-trifluoro-5-iodopyrimidine |
|---|---|
| PubChem CID | 143789968 |
| Molecular Formula | C4F3IN2 |
| Molecular Weight | 259.96 g/mol |
| Exact Mass | 259.91 |
| IUPAC Name | 2,4,6-trifluoro-5-iodopyrimidine |
| SMILES | Fc1nc(F)c(I)c(F)n1 |
| InChI | InChI=1S/C4F3IN2/c5-2-1(8)3(6)10-4(7)9-2 |
| InChIKey | DDFUCFZEJQAPBF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.96 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|