About 2,4,5-trifluoropyrimidine
2,4,5-trifluoropyrimidine (PubChem CID 12797307) has the molecular formula C4HF3N2
and a molecular weight of 134.06 g/mol. Its IUPAC name is 2,4,5-trifluoropyrimidine.
Molecular Properties
| Compound Name | 2,4,5-trifluoropyrimidine |
| PubChem CID | 12797307 |
| Molecular Formula | C4HF3N2 |
| Molecular Weight | 134.06 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | 2,4,5-trifluoropyrimidine |
| SMILES | Fc1ncc(F)c(F)n1 |
| InChI | InChI=1S/C4HF3N2/c5-2-1-8-4(7)9-3(2)6/h1H |
| InChIKey | LYBDHGMSPQBSNW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.06 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4,5-trifluoropyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-trifluoropyrimidine?
The IUPAC name of 2,4,5-trifluoropyrimidine (CID 12797307) is 2,4,5-trifluoropyrimidine.
What is the SMILES notation for 2,4,5-trifluoropyrimidine?
The canonical SMILES for 2,4,5-trifluoropyrimidine is Fc1ncc(F)c(F)n1.
What is the InChIKey of 2,4,5-trifluoropyrimidine?
The InChIKey is LYBDHGMSPQBSNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HF3N2/c5-2-1-8-4(7)9-3(2)6/h1H.
What are the key properties of 2,4,5-trifluoropyrimidine?
2,4,5-trifluoropyrimidine has a molecular weight of 134.06 g/mol, XLogP of 0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trifluoropyrimidine is sourced from PubChem (CID 12797307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).