C4HF3N2 — CID 12797307
2,4,5-trifluoropyrimidine (PubChem CID 12797307) has the molecular formula C4HF3N2 and a molecular weight of 134.06 g/mol. Its IUPAC name is 2,4,5-trifluoropyrimidine.
| Compound Name | 2,4,5-trifluoropyrimidine |
|---|---|
| PubChem CID | 12797307 |
| Molecular Formula | C4HF3N2 |
| Molecular Weight | 134.06 g/mol |
| Exact Mass | 134.01 |
| IUPAC Name | 2,4,5-trifluoropyrimidine |
| SMILES | Fc1ncc(F)c(F)n1 |
| InChI | InChI=1S/C4HF3N2/c5-2-1-8-4(7)9-3(2)6/h1H |
| InChIKey | LYBDHGMSPQBSNW-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.06 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |