About 2-fluoropyrimidin-5-ol
2-fluoropyrimidin-5-ol (PubChem CID 90720950) has the molecular formula C4H3FN2O
and a molecular weight of 114.08 g/mol. Its IUPAC name is 2-fluoropyrimidin-5-ol.
Molecular Properties
| Compound Name | 2-fluoropyrimidin-5-ol |
| PubChem CID | 90720950 |
| Molecular Formula | C4H3FN2O |
| Molecular Weight | 114.08 g/mol |
| Exact Mass | 114.02 |
| IUPAC Name | 2-fluoropyrimidin-5-ol |
| SMILES | Oc1cnc(F)nc1 |
| InChI | InChI=1S/C4H3FN2O/c5-4-6-1-3(8)2-7-4/h1-2,8H |
| InChIKey | IGGYUTVDIMQTGM-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.08 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoropyrimidin-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoropyrimidin-5-ol?
The IUPAC name of 2-fluoropyrimidin-5-ol (CID 90720950) is 2-fluoropyrimidin-5-ol.
What is the SMILES notation for 2-fluoropyrimidin-5-ol?
The canonical SMILES for 2-fluoropyrimidin-5-ol is Oc1cnc(F)nc1.
What is the InChIKey of 2-fluoropyrimidin-5-ol?
The InChIKey is IGGYUTVDIMQTGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3FN2O/c5-4-6-1-3(8)2-7-4/h1-2,8H.
What are the key properties of 2-fluoropyrimidin-5-ol?
2-fluoropyrimidin-5-ol has a molecular weight of 114.08 g/mol, XLogP of 0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoropyrimidin-5-ol is sourced from PubChem (CID 90720950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).