C7H4ClF4NO — CID 167738900
6-(2-chloro-1,1,2,2-tetrafluoroethyl)pyridin-3-ol (PubChem CID 167738900) has the molecular formula C7H4ClF4NO and a molecular weight of 229.56 g/mol. Its IUPAC name is 6-(2-chloro-1,1,2,2-tetrafluoroethyl)pyridin-3-ol.
| Compound Name | 6-(2-chloro-1,1,2,2-tetrafluoroethyl)pyridin-3-ol |
|---|---|
| PubChem CID | 167738900 |
| Molecular Formula | C7H4ClF4NO |
| Molecular Weight | 229.56 g/mol |
| Exact Mass | 228.99 |
| IUPAC Name | 6-(2-chloro-1,1,2,2-tetrafluoroethyl)pyridin-3-ol |
| SMILES | Oc1ccc(C(F)(F)C(F)(F)Cl)nc1 |
| InChI | InChI=1S/C7H4ClF4NO/c8-7(11,12)6(9,10)5-2-1-4(14)3-13-5/h1-3,14H |
| InChIKey | BLMZFYVXLNADJG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|