About acetic acid;6-(trifluoromethyl)pyridin-3-ol
acetic acid;6-(trifluoromethyl)pyridin-3-ol (PubChem CID 162333498) has the molecular formula C8H8F3NO3
and a molecular weight of 223.15 g/mol. Its IUPAC name is acetic acid;6-(trifluoromethyl)pyridin-3-ol.
Molecular Properties
| Compound Name | acetic acid;6-(trifluoromethyl)pyridin-3-ol |
| PubChem CID | 162333498 |
| Molecular Formula | C8H8F3NO3 |
| Molecular Weight | 223.15 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | acetic acid;6-(trifluoromethyl)pyridin-3-ol |
| SMILES | CC(=O)O.Oc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C6H4F3NO.C2H4O2/c7-6(8,9)5-2-1-4(11)3-10-5;1-2(3)4/h1-3,11H;1H3,(H,3,4) |
| InChIKey | VCOWEDGEDJBMBX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.15 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze acetic acid;6-(trifluoromethyl)pyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;6-(trifluoromethyl)pyridin-3-ol?
The IUPAC name of acetic acid;6-(trifluoromethyl)pyridin-3-ol (CID 162333498) is acetic acid;6-(trifluoromethyl)pyridin-3-ol.
What is the SMILES notation for acetic acid;6-(trifluoromethyl)pyridin-3-ol?
The canonical SMILES for acetic acid;6-(trifluoromethyl)pyridin-3-ol is CC(=O)O.Oc1ccc(C(F)(F)F)nc1.
What is the InChIKey of acetic acid;6-(trifluoromethyl)pyridin-3-ol?
The InChIKey is VCOWEDGEDJBMBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3NO.C2H4O2/c7-6(8,9)5-2-1-4(11)3-10-5;1-2(3)4/h1-3,11H;1H3,(H,3,4).
What are the key properties of acetic acid;6-(trifluoromethyl)pyridin-3-ol?
acetic acid;6-(trifluoromethyl)pyridin-3-ol has a molecular weight of 223.15 g/mol, XLogP of 1.90, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;6-(trifluoromethyl)pyridin-3-ol is sourced from PubChem (CID 162333498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).