acetic acid;6-(trifluoromethyl)pyridin-3-ol

C8H8F3NO3 — CID 162333498

IUPACacetic acid;6-(trifluoromethyl)pyridin-3-ol
SMILESCC(=O)O.Oc1ccc(C(F)(F)F)nc1
InChIInChI=1S/C6H4F3NO.C2H4O2/c7-6(8,9)5-2-1-4(11)3-10-5;1-2(3)4/h1-3,11H;1H3,(H,3,4)
InChIKeyVCOWEDGEDJBMBX-UHFFFAOYSA-N
MW223.15 g/mol
LogP1.90
Rot. Bonds

About acetic acid;6-(trifluoromethyl)pyridin-3-ol

acetic acid;6-(trifluoromethyl)pyridin-3-ol (PubChem CID 162333498) has the molecular formula C8H8F3NO3 and a molecular weight of 223.15 g/mol. Its IUPAC name is acetic acid;6-(trifluoromethyl)pyridin-3-ol.

Molecular Properties

Compound Nameacetic acid;6-(trifluoromethyl)pyridin-3-ol
PubChem CID162333498
Molecular FormulaC8H8F3NO3
Molecular Weight223.15 g/mol
Exact Mass223.05
IUPAC Nameacetic acid;6-(trifluoromethyl)pyridin-3-ol
SMILESCC(=O)O.Oc1ccc(C(F)(F)F)nc1
InChIInChI=1S/C6H4F3NO.C2H4O2/c7-6(8,9)5-2-1-4(11)3-10-5;1-2(3)4/h1-3,11H;1H3,(H,3,4)
InChIKeyVCOWEDGEDJBMBX-UHFFFAOYSA-N
XLogP1.90
TPSA70.42 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.15
LogP ≤ 51.90
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze acetic acid;6-(trifluoromethyl)pyridin-3-ol with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;6-(trifluoromethyl)pyridin-3-ol?
The IUPAC name of acetic acid;6-(trifluoromethyl)pyridin-3-ol (CID 162333498) is acetic acid;6-(trifluoromethyl)pyridin-3-ol.
What is the SMILES notation for acetic acid;6-(trifluoromethyl)pyridin-3-ol?
The canonical SMILES for acetic acid;6-(trifluoromethyl)pyridin-3-ol is CC(=O)O.Oc1ccc(C(F)(F)F)nc1.
What is the InChIKey of acetic acid;6-(trifluoromethyl)pyridin-3-ol?
The InChIKey is VCOWEDGEDJBMBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F3NO.C2H4O2/c7-6(8,9)5-2-1-4(11)3-10-5;1-2(3)4/h1-3,11H;1H3,(H,3,4).
What are the key properties of acetic acid;6-(trifluoromethyl)pyridin-3-ol?
acetic acid;6-(trifluoromethyl)pyridin-3-ol has a molecular weight of 223.15 g/mol, XLogP of 1.90, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;6-(trifluoromethyl)pyridin-3-ol is sourced from PubChem (CID 162333498), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).