C9H4F3NO — CID 107447186
5,7,8-trifluoroquinolin-3-ol (PubChem CID 107447186) has the molecular formula C9H4F3NO and a molecular weight of 199.13 g/mol. Its IUPAC name is 5,7,8-trifluoroquinolin-3-ol.
| Compound Name | 5,7,8-trifluoroquinolin-3-ol |
|---|---|
| PubChem CID | 107447186 |
| Molecular Formula | C9H4F3NO |
| Molecular Weight | 199.13 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 5,7,8-trifluoroquinolin-3-ol |
| SMILES | Oc1cnc2c(F)c(F)cc(F)c2c1 |
| InChI | InChI=1S/C9H4F3NO/c10-6-2-7(11)8(12)9-5(6)1-4(14)3-13-9/h1-3,14H |
| InChIKey | BVPQYEUPWHXRPC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.13 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|