About 5,7,8-trifluoroquinolin-3-ol
5,7,8-trifluoroquinolin-3-ol (PubChem CID 107447186) has the molecular formula C9H4F3NO
and a molecular weight of 199.13 g/mol. Its IUPAC name is 5,7,8-trifluoroquinolin-3-ol.
Molecular Properties
| Compound Name | 5,7,8-trifluoroquinolin-3-ol |
| PubChem CID | 107447186 |
| Molecular Formula | C9H4F3NO |
| Molecular Weight | 199.13 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 5,7,8-trifluoroquinolin-3-ol |
| SMILES | Oc1cnc2c(F)c(F)cc(F)c2c1 |
| InChI | InChI=1S/C9H4F3NO/c10-6-2-7(11)8(12)9-5(6)1-4(14)3-13-9/h1-3,14H |
| InChIKey | BVPQYEUPWHXRPC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.13 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 5,7,8-trifluoroquinolin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7,8-trifluoroquinolin-3-ol?
The IUPAC name of 5,7,8-trifluoroquinolin-3-ol (CID 107447186) is 5,7,8-trifluoroquinolin-3-ol.
What is the SMILES notation for 5,7,8-trifluoroquinolin-3-ol?
The canonical SMILES for 5,7,8-trifluoroquinolin-3-ol is Oc1cnc2c(F)c(F)cc(F)c2c1.
What is the InChIKey of 5,7,8-trifluoroquinolin-3-ol?
The InChIKey is BVPQYEUPWHXRPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4F3NO/c10-6-2-7(11)8(12)9-5(6)1-4(14)3-13-9/h1-3,14H.
What are the key properties of 5,7,8-trifluoroquinolin-3-ol?
5,7,8-trifluoroquinolin-3-ol has a molecular weight of 199.13 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7,8-trifluoroquinolin-3-ol is sourced from PubChem (CID 107447186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).