C12H2F6N2 — CID 23235431
1,2,4,6,7,9-hexafluorophenazine (PubChem CID 23235431) has the molecular formula C12H2F6N2 and a molecular weight of 288.15 g/mol. Its IUPAC name is 1,2,4,6,7,9-hexafluorophenazine.
| Compound Name | 1,2,4,6,7,9-hexafluorophenazine |
|---|---|
| PubChem CID | 23235431 |
| Molecular Formula | C12H2F6N2 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | 1,2,4,6,7,9-hexafluorophenazine |
| SMILES | Fc1cc(F)c2nc3c(F)c(F)cc(F)c3nc2c1F |
| InChI | InChI=1S/C12H2F6N2/c13-3-1-5(15)9-11(7(3)17)20-10-6(16)2-4(14)8(18)12(10)19-9/h1-2H |
| InChIKey | FKBGKROMVCBGKU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|