C11H4ClF6N — CID 63744575
4-chloro-5,7,8-trifluoro-3-methyl-2-(trifluoromethyl)quinoline (PubChem CID 63744575) has the molecular formula C11H4ClF6N and a molecular weight of 299.60 g/mol. Its IUPAC name is 4-chloro-5,7,8-trifluoro-3-methyl-2-(trifluoromethyl)quinoline.
| Compound Name | 4-chloro-5,7,8-trifluoro-3-methyl-2-(trifluoromethyl)quinoline |
|---|---|
| PubChem CID | 63744575 |
| Molecular Formula | C11H4ClF6N |
| Molecular Weight | 299.60 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | 4-chloro-5,7,8-trifluoro-3-methyl-2-(trifluoromethyl)quinoline |
| SMILES | Cc1c(C(F)(F)F)nc2c(F)c(F)cc(F)c2c1Cl |
| InChI | InChI=1S/C11H4ClF6N/c1-3-7(12)6-4(13)2-5(14)8(15)9(6)19-10(3)11(16,17)18/h2H,1H3 |
| InChIKey | LTAMYKRQFDUDEJ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.60 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|