About 5,8-dichloroquinolin-3-ol
5,8-dichloroquinolin-3-ol (PubChem CID 106989834) has the molecular formula C9H5Cl2NO
and a molecular weight of 214.05 g/mol. Its IUPAC name is 5,8-dichloroquinolin-3-ol.
Molecular Properties
| Compound Name | 5,8-dichloroquinolin-3-ol |
| PubChem CID | 106989834 |
| Molecular Formula | C9H5Cl2NO |
| Molecular Weight | 214.05 g/mol |
| Exact Mass | 212.97 |
| IUPAC Name | 5,8-dichloroquinolin-3-ol |
| SMILES | Oc1cnc2c(Cl)ccc(Cl)c2c1 |
| InChI | InChI=1S/C9H5Cl2NO/c10-7-1-2-8(11)9-6(7)3-5(13)4-12-9/h1-4,13H |
| InChIKey | ANERYYPXQKYLFP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.05 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,8-dichloroquinolin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dichloroquinolin-3-ol?
The IUPAC name of 5,8-dichloroquinolin-3-ol (CID 106989834) is 5,8-dichloroquinolin-3-ol.
What is the SMILES notation for 5,8-dichloroquinolin-3-ol?
The canonical SMILES for 5,8-dichloroquinolin-3-ol is Oc1cnc2c(Cl)ccc(Cl)c2c1.
What is the InChIKey of 5,8-dichloroquinolin-3-ol?
The InChIKey is ANERYYPXQKYLFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Cl2NO/c10-7-1-2-8(11)9-6(7)3-5(13)4-12-9/h1-4,13H.
What are the key properties of 5,8-dichloroquinolin-3-ol?
5,8-dichloroquinolin-3-ol has a molecular weight of 214.05 g/mol, XLogP of 3.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dichloroquinolin-3-ol is sourced from PubChem (CID 106989834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).