C11H5Cl4NO — CID 133092526
5-chloro-6-(2,3,6-trichlorophenyl)pyridin-3-ol (PubChem CID 133092526) has the molecular formula C11H5Cl4NO and a molecular weight of 308.98 g/mol. Its IUPAC name is 5-chloro-6-(2,3,6-trichlorophenyl)pyridin-3-ol.
| Compound Name | 5-chloro-6-(2,3,6-trichlorophenyl)pyridin-3-ol |
|---|---|
| PubChem CID | 133092526 |
| Molecular Formula | C11H5Cl4NO |
| Molecular Weight | 308.98 g/mol |
| Exact Mass | 306.91 |
| IUPAC Name | 5-chloro-6-(2,3,6-trichlorophenyl)pyridin-3-ol |
| SMILES | Oc1cnc(-c2c(Cl)ccc(Cl)c2Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H5Cl4NO/c12-6-1-2-7(13)10(15)9(6)11-8(14)3-5(17)4-16-11/h1-4,17H |
| InChIKey | VRNBOFWMGMGRTK-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.98 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|