About 2-fluoropyrido[4,3-d]pyrimidine
2-fluoropyrido[4,3-d]pyrimidine (PubChem CID 140973254) has the molecular formula C7H4FN3
and a molecular weight of 149.13 g/mol. Its IUPAC name is 2-fluoropyrido[4,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2-fluoropyrido[4,3-d]pyrimidine |
| PubChem CID | 140973254 |
| Molecular Formula | C7H4FN3 |
| Molecular Weight | 149.13 g/mol |
| Exact Mass | 149.04 |
| IUPAC Name | 2-fluoropyrido[4,3-d]pyrimidine |
| SMILES | Fc1ncc2cnccc2n1 |
| InChI | InChI=1S/C7H4FN3/c8-7-10-4-5-3-9-2-1-6(5)11-7/h1-4H |
| InChIKey | YBIFCJLJJBDXMJ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.13 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-fluoropyrido[4,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoropyrido[4,3-d]pyrimidine?
The IUPAC name of 2-fluoropyrido[4,3-d]pyrimidine (CID 140973254) is 2-fluoropyrido[4,3-d]pyrimidine.
What is the SMILES notation for 2-fluoropyrido[4,3-d]pyrimidine?
The canonical SMILES for 2-fluoropyrido[4,3-d]pyrimidine is Fc1ncc2cnccc2n1.
What is the InChIKey of 2-fluoropyrido[4,3-d]pyrimidine?
The InChIKey is YBIFCJLJJBDXMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FN3/c8-7-10-4-5-3-9-2-1-6(5)11-7/h1-4H.
What are the key properties of 2-fluoropyrido[4,3-d]pyrimidine?
2-fluoropyrido[4,3-d]pyrimidine has a molecular weight of 149.13 g/mol, XLogP of 1.16, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoropyrido[4,3-d]pyrimidine is sourced from PubChem (CID 140973254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).