C14H10FN3 — CID 171354245
3-(2-fluorophenyl)-1,6-naphthyridin-2-amine (PubChem CID 171354245) has the molecular formula C14H10FN3 and a molecular weight of 239.25 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1,6-naphthyridin-2-amine.
| Compound Name | 3-(2-fluorophenyl)-1,6-naphthyridin-2-amine |
|---|---|
| PubChem CID | 171354245 |
| Molecular Formula | C14H10FN3 |
| Molecular Weight | 239.25 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 3-(2-fluorophenyl)-1,6-naphthyridin-2-amine |
| SMILES | Nc1nc2ccncc2cc1-c1ccccc1F |
| InChI | InChI=1S/C14H10FN3/c15-12-4-2-1-3-10(12)11-7-9-8-17-6-5-13(9)18-14(11)16/h1-8H,(H2,16,18) |
| InChIKey | KBNGIGGSRUQSPI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.25 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |