C11H6F3N — CID 118801718
4-(2,3-difluorophenyl)-3-fluoropyridine (PubChem CID 118801718) has the molecular formula C11H6F3N and a molecular weight of 209.17 g/mol. Its IUPAC name is 4-(2,3-difluorophenyl)-3-fluoropyridine.
| Compound Name | 4-(2,3-difluorophenyl)-3-fluoropyridine |
|---|---|
| PubChem CID | 118801718 |
| Molecular Formula | C11H6F3N |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 4-(2,3-difluorophenyl)-3-fluoropyridine |
| SMILES | Fc1cnccc1-c1cccc(F)c1F |
| InChI | InChI=1S/C11H6F3N/c12-9-3-1-2-8(11(9)14)7-4-5-15-6-10(7)13/h1-6H |
| InChIKey | OSMOZDVJRYQELP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |