C13H18N2 — CID 142826315
butane;2-methyl-1,6-naphthyridine (PubChem CID 142826315) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is butane;2-methyl-1,6-naphthyridine.
| Compound Name | butane;2-methyl-1,6-naphthyridine |
|---|---|
| PubChem CID | 142826315 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | butane;2-methyl-1,6-naphthyridine |
| SMILES | CCCC.Cc1ccc2cnccc2n1 |
| InChI | InChI=1S/C9H8N2.C4H10/c1-7-2-3-8-6-10-5-4-9(8)11-7;1-3-4-2/h2-6H,1H3;3-4H2,1-2H3 |
| InChIKey | IIGRBHJVVSUGLY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |