C14H11F6N3 — CID 160690162
2-[4-(trifluoromethyl)phenyl]azetidine;2,4,5-trifluoropyrimidine (PubChem CID 160690162) has the molecular formula C14H11F6N3 and a molecular weight of 335.25 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]azetidine;2,4,5-trifluoropyrimidine.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]azetidine;2,4,5-trifluoropyrimidine |
|---|---|
| PubChem CID | 160690162 |
| Molecular Formula | C14H11F6N3 |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]azetidine;2,4,5-trifluoropyrimidine |
| SMILES | FC(F)(F)c1ccc(C2CCN2)cc1.Fc1ncc(F)c(F)n1 |
| InChI | InChI=1S/C10H10F3N.C4HF3N2/c11-10(12,13)8-3-1-7(2-4-8)9-5-6-14-9;5-2-1-8-4(7)9-3(2)6/h1-4,9,14H,5-6H2;1H |
| InChIKey | RPHNIFMJHVTKIK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |