C10H10F3NO — CID 105470618
3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine (PubChem CID 105470618) has the molecular formula C10H10F3NO and a molecular weight of 217.19 g/mol. Its IUPAC name is 3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine.
| Compound Name | 3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine |
|---|---|
| PubChem CID | 105470618 |
| Molecular Formula | C10H10F3NO |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 3-[4-(trifluoromethyl)phenyl]-1,2-oxazolidine |
| SMILES | FC(F)(F)c1ccc(C2CCON2)cc1 |
| InChI | InChI=1S/C10H10F3NO/c11-10(12,13)8-3-1-7(2-4-8)9-5-6-15-14-9/h1-4,9,14H,5-6H2 |
| InChIKey | UZXWHOLXGJKCMK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |