C16H12F3NO2 — CID 171184662
(4R)-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-oxazolidin-2-one (PubChem CID 171184662) has the molecular formula C16H12F3NO2 and a molecular weight of 307.27 g/mol. Its IUPAC name is (4R)-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 171184662 |
| Molecular Formula | C16H12F3NO2 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | (4R)-4-[4-[4-(trifluoromethyl)phenyl]phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@H](c2ccc(-c3ccc(C(F)(F)F)cc3)cc2)CO1 |
| InChI | InChI=1S/C16H12F3NO2/c17-16(18,19)13-7-5-11(6-8-13)10-1-3-12(4-2-10)14-9-22-15(21)20-14/h1-8,14H,9H2,(H,20,21)/t14-/m0/s1 |
| InChIKey | CBRXVTUYTANGHX-AWEZNQCLSA-N |
| XLogP | 4.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |