C14H14N2O3 — CID 170343835
4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 170343835) has the molecular formula C14H14N2O3 and a molecular weight of 258.28 g/mol. Its IUPAC name is 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 170343835 |
| Molecular Formula | C14H14N2O3 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 4-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | Cc1noc(C)c1-c1ccc(C2COC(=O)N2)cc1 |
| InChI | InChI=1S/C14H14N2O3/c1-8-13(9(2)19-16-8)11-5-3-10(4-6-11)12-7-18-14(17)15-12/h3-6,12H,7H2,1-2H3,(H,15,17) |
| InChIKey | LEPISGMEMVUFTD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |