C13H19NO2 — CID 144602725
ethane;ethene;4-phenyl-1,3-oxazolidin-2-one (PubChem CID 144602725) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is ethane;ethene;4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | ethane;ethene;4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 144602725 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | ethane;ethene;4-phenyl-1,3-oxazolidin-2-one |
| SMILES | C=C.CC.O=C1NC(c2ccccc2)CO1 |
| InChI | InChI=1S/C9H9NO2.C2H6.C2H4/c11-9-10-8(6-12-9)7-4-2-1-3-5-7;2*1-2/h1-5,8H,6H2,(H,10,11);1-2H3;1-2H2 |
| InChIKey | BVJCKLRACPGSFY-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|