C11H15NOS — CID 54377215
ethane;4-phenyl-1,3-oxazolidine-2-thione (PubChem CID 54377215) has the molecular formula C11H15NOS and a molecular weight of 209.31 g/mol. Its IUPAC name is ethane;4-phenyl-1,3-oxazolidine-2-thione.
| Compound Name | ethane;4-phenyl-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 54377215 |
| Molecular Formula | C11H15NOS |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | ethane;4-phenyl-1,3-oxazolidine-2-thione |
| SMILES | CC.S=C1NC(c2ccccc2)CO1 |
| InChI | InChI=1S/C9H9NOS.C2H6/c12-9-10-8(6-11-9)7-4-2-1-3-5-7;1-2/h1-5,8H,6H2,(H,10,12);1-2H3 |
| InChIKey | UXJLIEAAJQTCET-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|