C31H25N3O6 — CID 11103469
(5R,15R)-5,15-diphenyl-3,17-dioxa-6,14,23-triazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone (PubChem CID 11103469) has the molecular formula C31H25N3O6 and a molecular weight of 535.56 g/mol. Its IUPAC name is (5R,15R)-5,15-diphenyl-3,17-dioxa-6,14,23-triazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone.
| Compound Name | (5R,15R)-5,15-diphenyl-3,17-dioxa-6,14,23-triazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone |
|---|---|
| PubChem CID | 11103469 |
| Molecular Formula | C31H25N3O6 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | (5R,15R)-5,15-diphenyl-3,17-dioxa-6,14,23-triazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone |
| SMILES | O=C1N[C@H](c2ccccc2)COC(=O)c2cccc(n2)C(=O)OC[C@@H](c2ccccc2)NC(=O)c2cccc1c2 |
| InChI | InChI=1S/C31H25N3O6/c35-28-22-13-7-14-23(17-22)29(36)34-27(21-11-5-2-6-12-21)19-40-31(38)25-16-8-15-24(32-25)30(37)39-18-26(33-28)20-9-3-1-4-10-20/h1-17,26-27H,18-19H2,(H,33,35)(H,34,36)/t26-,27-/m0/s1 |
| InChIKey | MUAFFCQXLPUBLR-SVBPBHIXSA-N |
| XLogP | 4.05 |
| TPSA | 123.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |