C26H21NO2 — CID 169180721
2-(1,3-dioxolan-2-yl)-6-(3,5-diphenylphenyl)pyridine (PubChem CID 169180721) has the molecular formula C26H21NO2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-yl)-6-(3,5-diphenylphenyl)pyridine.
| Compound Name | 2-(1,3-dioxolan-2-yl)-6-(3,5-diphenylphenyl)pyridine |
|---|---|
| PubChem CID | 169180721 |
| Molecular Formula | C26H21NO2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-(1,3-dioxolan-2-yl)-6-(3,5-diphenylphenyl)pyridine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cccc(C4OCCO4)n3)c2)cc1 |
| InChI | InChI=1S/C26H21NO2/c1-3-8-19(9-4-1)21-16-22(20-10-5-2-6-11-20)18-23(17-21)24-12-7-13-25(27-24)26-28-14-15-29-26/h1-13,16-18,26H,14-15H2 |
| InChIKey | IVGFURNBJSWOMY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |