C81H55N — CID 166563571
2-[3,5-bis[3-(3,5-diphenylphenyl)phenyl]phenyl]-6-(3,6-diphenylnaphthalen-1-yl)pyridine (PubChem CID 166563571) has the molecular formula C81H55N and a molecular weight of 1042.34 g/mol. Its IUPAC name is 2-[3,5-bis[3-(3,5-diphenylphenyl)phenyl]phenyl]-6-(3,6-diphenylnaphthalen-1-yl)pyridine.
| Compound Name | 2-[3,5-bis[3-(3,5-diphenylphenyl)phenyl]phenyl]-6-(3,6-diphenylnaphthalen-1-yl)pyridine |
|---|---|
| PubChem CID | 166563571 |
| Molecular Formula | C81H55N |
| Molecular Weight | 1042.34 g/mol |
| Exact Mass | 1041.43 |
| IUPAC Name | 2-[3,5-bis[3-(3,5-diphenylphenyl)phenyl]phenyl]-6-(3,6-diphenylnaphthalen-1-yl)pyridine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cccc(-c4cc(-c5cccc(-c6cc(-c7ccccc7)cc(-c7ccccc7)c6)c5)cc(-c5cccc(-c6cc(-c7ccccc7)cc7cc(-c8ccccc8)ccc67)n5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C81H55N/c1-7-22-56(23-8-1)66-40-41-78-76(44-66)52-75(61-32-17-6-18-33-61)55-79(78)81-39-21-38-80(82-81)77-53-73(64-36-19-34-62(42-64)71-47-67(57-24-9-2-10-25-57)45-68(48-71)58-26-11-3-12-27-58)51-74(54-77)65-37-20-35-63(43-65)72-49-69(59-28-13-4-14-29-59)46-70(50-72)60-30-15-5-16-31-60/h1-55H |
| InChIKey | VWYDWOWHUZSXPD-UHFFFAOYSA-N |
| XLogP | 22.24 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1042.34 |
| LogP ≤ 5 | 22.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |