C40H28N2 — CID 172850530
2,4-bis(3,5-diphenylphenyl)pyrimidine (PubChem CID 172850530) has the molecular formula C40H28N2 and a molecular weight of 536.68 g/mol. Its IUPAC name is 2,4-bis(3,5-diphenylphenyl)pyrimidine.
| Compound Name | 2,4-bis(3,5-diphenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 172850530 |
| Molecular Formula | C40H28N2 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 2,4-bis(3,5-diphenylphenyl)pyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3ccnc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)n3)c2)cc1 |
| InChI | InChI=1S/C40H28N2/c1-5-13-29(14-6-1)33-23-34(30-15-7-2-8-16-30)26-37(25-33)39-21-22-41-40(42-39)38-27-35(31-17-9-3-10-18-31)24-36(28-38)32-19-11-4-12-20-32/h1-28H |
| InChIKey | XZUBCYOJVDXVPU-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |