C34H24N2 — CID 175536318
2,4-diphenylpyrimidine;triphenylene (PubChem CID 175536318) has the molecular formula C34H24N2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 2,4-diphenylpyrimidine;triphenylene.
| Compound Name | 2,4-diphenylpyrimidine;triphenylene |
|---|---|
| PubChem CID | 175536318 |
| Molecular Formula | C34H24N2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | 2,4-diphenylpyrimidine;triphenylene |
| SMILES | c1ccc(-c2ccnc(-c3ccccc3)n2)cc1.c1ccc2c(c1)c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C18H12.C16H12N2/c1-2-8-14-13(7-1)15-9-3-4-11-17(15)18-12-6-5-10-16(14)18;1-3-7-13(8-4-1)15-11-12-17-16(18-15)14-9-5-2-6-10-14/h2*1-12H |
| InChIKey | ZWAXCGABGLDDJV-UHFFFAOYSA-N |
| XLogP | 8.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|