C16H12N2Y — CID 59738567
2,4-diphenylpyrimidine;yttrium (PubChem CID 59738567) has the molecular formula C16H12N2Y and a molecular weight of 321.19 g/mol. Its IUPAC name is 2,4-diphenylpyrimidine;yttrium.
| Compound Name | 2,4-diphenylpyrimidine;yttrium |
|---|---|
| PubChem CID | 59738567 |
| Molecular Formula | C16H12N2Y |
| Molecular Weight | 321.19 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 2,4-diphenylpyrimidine;yttrium |
| SMILES | [Y].c1ccc(-c2ccnc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C16H12N2.Y/c1-3-7-13(8-4-1)15-11-12-17-16(18-15)14-9-5-2-6-10-14;/h1-12H; |
| InChIKey | JJJGFCDYESFGDL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.19 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |