C24H26N2O6 — CID 15449519
5,15-diethyl-3,17-dioxa-6,14-diazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone (PubChem CID 15449519) has the molecular formula C24H26N2O6 and a molecular weight of 438.48 g/mol. Its IUPAC name is 5,15-diethyl-3,17-dioxa-6,14-diazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone.
| Compound Name | 5,15-diethyl-3,17-dioxa-6,14-diazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone |
|---|---|
| PubChem CID | 15449519 |
| Molecular Formula | C24H26N2O6 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 5,15-diethyl-3,17-dioxa-6,14-diazatricyclo[17.3.1.18,12]tetracosa-1(23),8(24),9,11,19,21-hexaene-2,7,13,18-tetrone |
| SMILES | CCC1COC(=O)c2cccc(c2)C(=O)OCC(CC)NC(=O)c2cccc(c2)C(=O)N1 |
| InChI | InChI=1S/C24H26N2O6/c1-3-19-13-31-23(29)17-9-6-10-18(12-17)24(30)32-14-20(4-2)26-22(28)16-8-5-7-15(11-16)21(27)25-19/h5-12,19-20H,3-4,13-14H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | LCSMWGIKKUEOAV-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |