C10H12FNO — CID 84618499
3-ethyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 84618499) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is 3-ethyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 3-ethyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 84618499 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 3-ethyl-8-fluoro-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CCC1COc2c(F)cccc2N1 |
| InChI | InChI=1S/C10H12FNO/c1-2-7-6-13-10-8(11)4-3-5-9(10)12-7/h3-5,7,12H,2,6H2,1H3 |
| InChIKey | OYIWZQDDJLOQFO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |