C10H15N3O — CID 84619164
3-(methylaminomethyl)-3,4-dihydro-2H-1,4-benzoxazin-8-amine (PubChem CID 84619164) has the molecular formula C10H15N3O and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-(methylaminomethyl)-3,4-dihydro-2H-1,4-benzoxazin-8-amine.
| Compound Name | 3-(methylaminomethyl)-3,4-dihydro-2H-1,4-benzoxazin-8-amine |
|---|---|
| PubChem CID | 84619164 |
| Molecular Formula | C10H15N3O |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.12 |
| IUPAC Name | 3-(methylaminomethyl)-3,4-dihydro-2H-1,4-benzoxazin-8-amine |
| SMILES | CNCC1COc2c(N)cccc2N1 |
| InChI | InChI=1S/C10H15N3O/c1-12-5-7-6-14-10-8(11)3-2-4-9(10)13-7/h2-4,7,12-13H,5-6,11H2,1H3 |
| InChIKey | QCIIEGQENJOPAU-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|