C9H10FNO — CID 84652608
3-(fluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 84652608) has the molecular formula C9H10FNO and a molecular weight of 167.18 g/mol. Its IUPAC name is 3-(fluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 3-(fluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 84652608 |
| Molecular Formula | C9H10FNO |
| Molecular Weight | 167.18 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 3-(fluoromethyl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | FCC1COc2ccccc2N1 |
| InChI | InChI=1S/C9H10FNO/c10-5-7-6-12-9-4-2-1-3-8(9)11-7/h1-4,7,11H,5-6H2 |
| InChIKey | KFQCMVRUSXLWGA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |