C20H22N2O6S2 — CID 11465101
(5R,14R)-5,14-diethyl-3,16-dioxa-21,22-dithia-6,13-diazatricyclo[16.2.1.18,11]docosa-1(20),8,10,18-tetraene-2,7,12,17-tetrone (PubChem CID 11465101) has the molecular formula C20H22N2O6S2 and a molecular weight of 450.54 g/mol. Its IUPAC name is (5R,14R)-5,14-diethyl-3,16-dioxa-21,22-dithia-6,13-diazatricyclo[16.2.1.18,11]docosa-1(20),8,10,18-tetraene-2,7,12,17-tetrone.
| Compound Name | (5R,14R)-5,14-diethyl-3,16-dioxa-21,22-dithia-6,13-diazatricyclo[16.2.1.18,11]docosa-1(20),8,10,18-tetraene-2,7,12,17-tetrone |
|---|---|
| PubChem CID | 11465101 |
| Molecular Formula | C20H22N2O6S2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | (5R,14R)-5,14-diethyl-3,16-dioxa-21,22-dithia-6,13-diazatricyclo[16.2.1.18,11]docosa-1(20),8,10,18-tetraene-2,7,12,17-tetrone |
| SMILES | CC[C@@H]1COC(=O)c2ccc(s2)C(=O)OC[C@@H](CC)NC(=O)c2ccc(s2)C(=O)N1 |
| InChI | InChI=1S/C20H22N2O6S2/c1-3-11-9-27-19(25)15-7-8-16(30-15)20(26)28-10-12(4-2)22-18(24)14-6-5-13(29-14)17(23)21-11/h5-8,11-12H,3-4,9-10H2,1-2H3,(H,21,23)(H,22,24)/t11-,12-/m1/s1 |
| InChIKey | UJQXIEXNMNABCF-VXGBXAGGSA-N |
| XLogP | 2.85 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |