C9H20N2O3 — CID 159356389
(2R)-2-aminobutan-1-ol;(4R)-4-ethyl-1,3-oxazolidin-2-one (PubChem CID 159356389) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is (2R)-2-aminobutan-1-ol;(4R)-4-ethyl-1,3-oxazolidin-2-one.
| Compound Name | (2R)-2-aminobutan-1-ol;(4R)-4-ethyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 159356389 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | (2R)-2-aminobutan-1-ol;(4R)-4-ethyl-1,3-oxazolidin-2-one |
| SMILES | CC[C@@H](N)CO.CC[C@@H]1COC(=O)N1 |
| InChI | InChI=1S/C5H9NO2.C4H11NO/c1-2-4-3-8-5(7)6-4;1-2-4(5)3-6/h4H,2-3H2,1H3,(H,6,7);4,6H,2-3,5H2,1H3/t2*4-/m11/s1 |
| InChIKey | LHYYIZRGDPGBMP-DGPROHSZSA-N |
| XLogP | 0.22 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |