C11H11NO4 — CID 21335894
5-[(4-hydroxyphenyl)methyl]morpholine-2,3-dione (PubChem CID 21335894) has the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. Its IUPAC name is 5-[(4-hydroxyphenyl)methyl]morpholine-2,3-dione.
| Compound Name | 5-[(4-hydroxyphenyl)methyl]morpholine-2,3-dione |
|---|---|
| PubChem CID | 21335894 |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 5-[(4-hydroxyphenyl)methyl]morpholine-2,3-dione |
| SMILES | O=C1NC(Cc2ccc(O)cc2)COC1=O |
| InChI | InChI=1S/C11H11NO4/c13-9-3-1-7(2-4-9)5-8-6-16-11(15)10(14)12-8/h1-4,8,13H,5-6H2,(H,12,14) |
| InChIKey | TVQKCRIOGXZJLY-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|