C13H13NO3 — CID 102189345
(3S,6Z)-3-benzyl-3,4-dihydro-2H-1,4-oxazocine-5,8-dione (PubChem CID 102189345) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is (3S,6Z)-3-benzyl-3,4-dihydro-2H-1,4-oxazocine-5,8-dione.
| Compound Name | (3S,6Z)-3-benzyl-3,4-dihydro-2H-1,4-oxazocine-5,8-dione |
|---|---|
| PubChem CID | 102189345 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | (3S,6Z)-3-benzyl-3,4-dihydro-2H-1,4-oxazocine-5,8-dione |
| SMILES | O=C1/C=C\C(=O)OC[C@H](Cc2ccccc2)N1 |
| InChI | InChI=1S/C13H13NO3/c15-12-6-7-13(16)17-9-11(14-12)8-10-4-2-1-3-5-10/h1-7,11H,8-9H2,(H,14,15)/b7-6-/t11-/m0/s1 |
| InChIKey | VLWMJUQNUFCKCX-ZADCQDASSA-N |
| XLogP | 0.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |