C10H10INO2 — CID 175523266
4-[(4-iodophenyl)methyl]-1,3-oxazolidin-2-one (PubChem CID 175523266) has the molecular formula C10H10INO2 and a molecular weight of 303.10 g/mol. Its IUPAC name is 4-[(4-iodophenyl)methyl]-1,3-oxazolidin-2-one.
| Compound Name | 4-[(4-iodophenyl)methyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 175523266 |
| Molecular Formula | C10H10INO2 |
| Molecular Weight | 303.10 g/mol |
| Exact Mass | 302.98 |
| IUPAC Name | 4-[(4-iodophenyl)methyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1NC(Cc2ccc(I)cc2)CO1 |
| InChI | InChI=1S/C10H10INO2/c11-8-3-1-7(2-4-8)5-9-6-14-10(13)12-9/h1-4,9H,5-6H2,(H,12,13) |
| InChIKey | UFTWBKANOQMMQU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.10 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|