C9H9NO2 — CID 730424
(4S)-4-phenyl-1,3-oxazolidin-2-one (PubChem CID 730424) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is (4S)-4-phenyl-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 730424 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | (4S)-4-phenyl-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C9H9NO2/c11-9-10-8(6-12-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H,10,11)/t8-/m1/s1 |
| InChIKey | QDMNNMIOWVJVLY-MRVPVSSYSA-N |
| XLogP | 1.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |