About (2-amino-3-phenylpropyl) carbamate
(2-amino-3-phenylpropyl) carbamate (PubChem CID 11708214) has the molecular formula C10H14N2O2
and a molecular weight of 194.23 g/mol. Its IUPAC name is (2-amino-3-phenylpropyl) carbamate.
Molecular Properties
| Compound Name | (2-amino-3-phenylpropyl) carbamate |
| PubChem CID | 11708214 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (2-amino-3-phenylpropyl) carbamate |
| SMILES | NC(=O)OCC(N)Cc1ccccc1 |
| InChI | InChI=1S/C10H14N2O2/c11-9(7-14-10(12)13)6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H2,12,13) |
| InChIKey | UCTRAOBQFUDCSR-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-amino-3-phenylpropyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-3-phenylpropyl) carbamate?
The IUPAC name of (2-amino-3-phenylpropyl) carbamate (CID 11708214) is (2-amino-3-phenylpropyl) carbamate.
What is the SMILES notation for (2-amino-3-phenylpropyl) carbamate?
The canonical SMILES for (2-amino-3-phenylpropyl) carbamate is NC(=O)OCC(N)Cc1ccccc1.
What is the InChIKey of (2-amino-3-phenylpropyl) carbamate?
The InChIKey is UCTRAOBQFUDCSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2/c11-9(7-14-10(12)13)6-8-4-2-1-3-5-8/h1-5,9H,6-7,11H2,(H2,12,13).
What are the key properties of (2-amino-3-phenylpropyl) carbamate?
(2-amino-3-phenylpropyl) carbamate has a molecular weight of 194.23 g/mol, XLogP of 0.65, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-3-phenylpropyl) carbamate is sourced from PubChem (CID 11708214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).