C10H11LiNO2+ — CID 21353540
lithium (4S)-4-benzyl-1,3-oxazolidin-2-one (PubChem CID 21353540) has the molecular formula C10H11LiNO2+ and a molecular weight of 184.14 g/mol. Its IUPAC name is lithium (4S)-4-benzyl-1,3-oxazolidin-2-one.
| Compound Name | lithium (4S)-4-benzyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 21353540 |
| Molecular Formula | C10H11LiNO2+ |
| Molecular Weight | 184.14 g/mol |
| Exact Mass | 184.09 |
| IUPAC Name | lithium (4S)-4-benzyl-1,3-oxazolidin-2-one |
| SMILES | O=C1N[C@@H](Cc2ccccc2)CO1.[Li+] |
| InChI | InChI=1S/C10H11NO2.Li/c12-10-11-9(7-13-10)6-8-4-2-1-3-5-8;/h1-5,9H,6-7H2,(H,11,12);/q;+1/t9-;/m0./s1 |
| InChIKey | UNWHDOBWJMTBIY-FVGYRXGTSA-N |
| XLogP | -1.66 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.14 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |